C30H20F3N5O — CID 157042964
N-[3-(pyridin-4-ylamino)phenyl]-3-[[6-(3,3,3-trifluoroprop-1-ynyl)quinolin-4-yl]amino]benzamide (PubChem CID 157042964) has the molecular formula C30H20F3N5O and a molecular weight of 523.52 g/mol. Its IUPAC name is N-[3-(pyridin-4-ylamino)phenyl]-3-[[6-(3,3,3-trifluoroprop-1-ynyl)quinolin-4-yl]amino]benzamide.
| Compound Name | N-[3-(pyridin-4-ylamino)phenyl]-3-[[6-(3,3,3-trifluoroprop-1-ynyl)quinolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 157042964 |
| Molecular Formula | C30H20F3N5O |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-[3-(pyridin-4-ylamino)phenyl]-3-[[6-(3,3,3-trifluoroprop-1-ynyl)quinolin-4-yl]amino]benzamide |
| SMILES | O=C(Nc1cccc(Nc2ccncc2)c1)c1cccc(Nc2ccnc3ccc(C#CC(F)(F)F)cc23)c1 |
| InChI | InChI=1S/C30H20F3N5O/c31-30(32,33)13-9-20-7-8-27-26(17-20)28(12-16-35-27)37-23-4-1-3-21(18-23)29(39)38-25-6-2-5-24(19-25)36-22-10-14-34-15-11-22/h1-8,10-12,14-19H,(H,34,36)(H,35,37)(H,38,39) |
| InChIKey | JNYZFXBGWLXSHT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|