C27H19N7O — CID 157042999
6-[(6-cyanoquinolin-4-yl)amino]-N-[3-(pyridin-4-ylamino)phenyl]pyridine-2-carboxamide (PubChem CID 157042999) has the molecular formula C27H19N7O and a molecular weight of 457.50 g/mol. Its IUPAC name is 6-[(6-cyanoquinolin-4-yl)amino]-N-[3-(pyridin-4-ylamino)phenyl]pyridine-2-carboxamide.
| Compound Name | 6-[(6-cyanoquinolin-4-yl)amino]-N-[3-(pyridin-4-ylamino)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 157042999 |
| Molecular Formula | C27H19N7O |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 6-[(6-cyanoquinolin-4-yl)amino]-N-[3-(pyridin-4-ylamino)phenyl]pyridine-2-carboxamide |
| SMILES | N#Cc1ccc2nccc(Nc3cccc(C(=O)Nc4cccc(Nc5ccncc5)c4)n3)c2c1 |
| InChI | InChI=1S/C27H19N7O/c28-17-18-7-8-23-22(15-18)24(11-14-30-23)33-26-6-2-5-25(34-26)27(35)32-21-4-1-3-20(16-21)31-19-9-12-29-13-10-19/h1-16H,(H,29,31)(H,32,35)(H,30,33,34) |
| InChIKey | YEILFGMZGRSMJP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |