C28H22N6O — CID 170018734
4-[3-[hydroxy-[3-(pyridin-4-ylamino)anilino]methyl]anilino]quinoline-6-carbonitrile (PubChem CID 170018734) has the molecular formula C28H22N6O and a molecular weight of 458.53 g/mol. Its IUPAC name is 4-[3-[hydroxy-[3-(pyridin-4-ylamino)anilino]methyl]anilino]quinoline-6-carbonitrile.
| Compound Name | 4-[3-[hydroxy-[3-(pyridin-4-ylamino)anilino]methyl]anilino]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 170018734 |
| Molecular Formula | C28H22N6O |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-[3-[hydroxy-[3-(pyridin-4-ylamino)anilino]methyl]anilino]quinoline-6-carbonitrile |
| SMILES | N#Cc1ccc2nccc(Nc3cccc(C(O)Nc4cccc(Nc5ccncc5)c4)c3)c2c1 |
| InChI | InChI=1S/C28H22N6O/c29-18-19-7-8-26-25(15-19)27(11-14-31-26)33-22-4-1-3-20(16-22)28(35)34-24-6-2-5-23(17-24)32-21-9-12-30-13-10-21/h1-17,28,34-35H,(H,30,32)(H,31,33) |
| InChIKey | FKGXBHOCDGOLMF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|