C28H21N6OP — CID 170232036
4-[(6-cyanoquinolin-4-yl)amino]-N-[3-phosphanyl-5-(pyridin-4-ylamino)phenyl]benzamide (PubChem CID 170232036) has the molecular formula C28H21N6OP and a molecular weight of 488.49 g/mol. Its IUPAC name is 4-[(6-cyanoquinolin-4-yl)amino]-N-[3-phosphanyl-5-(pyridin-4-ylamino)phenyl]benzamide.
| Compound Name | 4-[(6-cyanoquinolin-4-yl)amino]-N-[3-phosphanyl-5-(pyridin-4-ylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 170232036 |
| Molecular Formula | C28H21N6OP |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 4-[(6-cyanoquinolin-4-yl)amino]-N-[3-phosphanyl-5-(pyridin-4-ylamino)phenyl]benzamide |
| SMILES | N#Cc1ccc2nccc(Nc3ccc(C(=O)Nc4cc(P)cc(Nc5ccncc5)c4)cc3)c2c1 |
| InChI | InChI=1S/C28H21N6OP/c29-17-18-1-6-26-25(13-18)27(9-12-31-26)33-20-4-2-19(3-5-20)28(35)34-23-14-22(15-24(36)16-23)32-21-7-10-30-11-8-21/h1-16H,36H2,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | UUYOPHQRADCBKM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|