C28H20N6O — CID 157044061
4-[(7-cyanoisoquinolin-1-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide (PubChem CID 157044061) has the molecular formula C28H20N6O and a molecular weight of 456.51 g/mol. Its IUPAC name is 4-[(7-cyanoisoquinolin-1-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide.
| Compound Name | 4-[(7-cyanoisoquinolin-1-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 157044061 |
| Molecular Formula | C28H20N6O |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4-[(7-cyanoisoquinolin-1-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide |
| SMILES | N#Cc1ccc2ccnc(Nc3ccc(C(=O)Nc4ccc(Nc5ccncc5)cc4)cc3)c2c1 |
| InChI | InChI=1S/C28H20N6O/c29-18-19-1-2-20-11-16-31-27(26(20)17-19)33-23-5-3-21(4-6-23)28(35)34-24-9-7-22(8-10-24)32-25-12-14-30-15-13-25/h1-17H,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | LDUXKWZPBGZFKQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |