C29H24N4O2 — CID 170001905
3-anilino-N-[3-[(6-methoxyquinolin-4-yl)amino]phenyl]benzamide (PubChem CID 170001905) has the molecular formula C29H24N4O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 3-anilino-N-[3-[(6-methoxyquinolin-4-yl)amino]phenyl]benzamide.
| Compound Name | 3-anilino-N-[3-[(6-methoxyquinolin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 170001905 |
| Molecular Formula | C29H24N4O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 3-anilino-N-[3-[(6-methoxyquinolin-4-yl)amino]phenyl]benzamide |
| SMILES | COc1ccc2nccc(Nc3cccc(NC(=O)c4cccc(Nc5ccccc5)c4)c3)c2c1 |
| InChI | InChI=1S/C29H24N4O2/c1-35-25-13-14-27-26(19-25)28(15-16-30-27)32-23-11-6-12-24(18-23)33-29(34)20-7-5-10-22(17-20)31-21-8-3-2-4-9-21/h2-19,31H,1H3,(H,30,32)(H,33,34) |
| InChIKey | UVHVFSHFNAZQEQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |