C28H24N5OP — CID 170225894
4-[(6-methylquinolin-4-yl)amino]-3-phosphanyl-N-[3-(pyridin-4-ylamino)phenyl]benzamide (PubChem CID 170225894) has the molecular formula C28H24N5OP and a molecular weight of 477.51 g/mol. Its IUPAC name is 4-[(6-methylquinolin-4-yl)amino]-3-phosphanyl-N-[3-(pyridin-4-ylamino)phenyl]benzamide.
| Compound Name | 4-[(6-methylquinolin-4-yl)amino]-3-phosphanyl-N-[3-(pyridin-4-ylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 170225894 |
| Molecular Formula | C28H24N5OP |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[(6-methylquinolin-4-yl)amino]-3-phosphanyl-N-[3-(pyridin-4-ylamino)phenyl]benzamide |
| SMILES | Cc1ccc2nccc(Nc3ccc(C(=O)Nc4cccc(Nc5ccncc5)c4)cc3P)c2c1 |
| InChI | InChI=1S/C28H24N5OP/c1-18-5-7-24-23(15-18)25(11-14-30-24)33-26-8-6-19(16-27(26)35)28(34)32-22-4-2-3-21(17-22)31-20-9-12-29-13-10-20/h2-17H,35H2,1H3,(H,29,31)(H,30,33)(H,32,34) |
| InChIKey | JQAOKLWFWPBWEN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|