C27H20N4O2 — CID 166832857
N-(4-pyridin-4-yloxyphenyl)-3-(quinolin-4-ylamino)benzamide (PubChem CID 166832857) has the molecular formula C27H20N4O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(4-pyridin-4-yloxyphenyl)-3-(quinolin-4-ylamino)benzamide.
| Compound Name | N-(4-pyridin-4-yloxyphenyl)-3-(quinolin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 166832857 |
| Molecular Formula | C27H20N4O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-(4-pyridin-4-yloxyphenyl)-3-(quinolin-4-ylamino)benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccncc2)cc1)c1cccc(Nc2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C27H20N4O2/c32-27(31-20-8-10-22(11-9-20)33-23-12-15-28-16-13-23)19-4-3-5-21(18-19)30-26-14-17-29-25-7-2-1-6-24(25)26/h1-18H,(H,29,30)(H,31,32) |
| InChIKey | OHDMBLIKKDBTSJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |