C16H16N6O3 — CID 90897121
N-[3-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-nitrobenzamide (PubChem CID 90897121) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is N-[3-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 90897121 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[3-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-nitrobenzamide |
| SMILES | CC(=NN=C(N)N)c1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C16H16N6O3/c1-10(20-21-16(17)18)12-3-2-4-13(9-12)19-15(23)11-5-7-14(8-6-11)22(24)25/h2-9H,1H3,(H,19,23)(H4,17,18,21) |
| InChIKey | UCPCAUQMDQJGMX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|