C31H39N19O2 — CID 10212250
3-N,5-N-bis[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]pyridine-3,5-dicarboxamide (PubChem CID 10212250) has the molecular formula C31H39N19O2 and a molecular weight of 709.78 g/mol. Its IUPAC name is 3-N,5-N-bis[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 10212250 |
| Molecular Formula | C31H39N19O2 |
| Molecular Weight | 709.78 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | 3-N,5-N-bis[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]pyridine-3,5-dicarboxamide |
| SMILES | C/C(=N\N=C(N)N)c1cc(NC(=O)c2cncc(C(=O)Nc3cc(/C(C)=N/N=C(N)N)cc(/C(C)=N/N=C(N)N)c3)c2)cc(/C(C)=N/N=C(N)N)c1 |
| InChI | InChI=1S/C31H39N19O2/c1-14(43-47-28(32)33)18-5-19(15(2)44-48-29(34)35)9-24(8-18)41-26(51)22-7-23(13-40-12-22)27(52)42-25-10-20(16(3)45-49-30(36)37)6-21(11-25)17(4)46-50-31(38)39/h5-13H,1-4H3,(H,41,51)(H,42,52)(H4,32,33,47)(H4,34,35,48)(H4,36,37,49)(H4,38,39,50)/b43-14+,44-15+,45-16+,46-17+ |
| InChIKey | YFIAYRQDXWNXPN-LWAAEHHESA-N |
| XLogP | -0.42 |
| TPSA | 378.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.78 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|