C16H17BrN6O — CID 25131059
1-(4-bromophenyl)-3-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea (PubChem CID 25131059) has the molecular formula C16H17BrN6O and a molecular weight of 389.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea |
|---|---|
| PubChem CID | 25131059 |
| Molecular Formula | C16H17BrN6O |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-(4-bromophenyl)-3-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea |
| SMILES | C/C(=N\N=C(N)N)c1ccc(NC(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H17BrN6O/c1-10(22-23-15(18)19)11-2-6-13(7-3-11)20-16(24)21-14-8-4-12(17)5-9-14/h2-9H,1H3,(H4,18,19,23)(H2,20,21,24)/b22-10+ |
| InChIKey | PVTMXGQGZTXNLE-LSHDLFTRSA-N |
| XLogP | 3.09 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|