C17H17N7O — CID 123570026
1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-isocyanophenyl)urea (PubChem CID 123570026) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is 1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-isocyanophenyl)urea.
| Compound Name | 1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-isocyanophenyl)urea |
|---|---|
| PubChem CID | 123570026 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-isocyanophenyl)urea |
| SMILES | [C-]#[N+]c1ccc(NC(=O)Nc2ccc(/C(C)=N\N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C17H17N7O/c1-11(23-24-16(18)19)12-3-5-14(6-4-12)21-17(25)22-15-9-7-13(20-2)8-10-15/h3-10H,1H3,(H4,18,19,24)(H2,21,22,25)/b23-11- |
| InChIKey | QAEBJRQGFYURDM-KSEXSDGBSA-N |
| XLogP | 2.88 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|