C19H21N5O2S — CID 91139088
methyl N'-[(Z)-1-[4-[(4-acetylphenyl)carbamoylamino]phenyl]ethylideneamino]carbamimidothioate (PubChem CID 91139088) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is methyl N'-[(Z)-1-[4-[(4-acetylphenyl)carbamoylamino]phenyl]ethylideneamino]carbamimidothioate.
| Compound Name | methyl N'-[(Z)-1-[4-[(4-acetylphenyl)carbamoylamino]phenyl]ethylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 91139088 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | methyl N'-[(Z)-1-[4-[(4-acetylphenyl)carbamoylamino]phenyl]ethylideneamino]carbamimidothioate |
| SMILES | CSC(N)=N/N=C(/C)c1ccc(NC(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H21N5O2S/c1-12(23-24-18(20)27-3)14-4-8-16(9-5-14)21-19(26)22-17-10-6-15(7-11-17)13(2)25/h4-11H,1-3H3,(H2,20,24)(H2,21,22,26)/b23-12- |
| InChIKey | PHUAMIPGOIUTRT-FMCGGJTJSA-N |
| XLogP | 3.93 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|