C26H36N4O6 — CID 24846144
N'-ethyl-4-[(Z)-2-[4-(N'-ethylcarbamimidoyl)phenyl]ethenyl]benzenecarboximidamide;bis(2-hydroxypropanoic acid) (PubChem CID 24846144) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is N'-ethyl-4-[(Z)-2-[4-(N'-ethylcarbamimidoyl)phenyl]ethenyl]benzenecarboximidamide;bis(2-hydroxypropanoic acid).
| Compound Name | N'-ethyl-4-[(Z)-2-[4-(N'-ethylcarbamimidoyl)phenyl]ethenyl]benzenecarboximidamide;bis(2-hydroxypropanoic acid) |
|---|---|
| PubChem CID | 24846144 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | N'-ethyl-4-[(Z)-2-[4-(N'-ethylcarbamimidoyl)phenyl]ethenyl]benzenecarboximidamide;bis(2-hydroxypropanoic acid) |
| SMILES | CC(O)C(=O)O.CC(O)C(=O)O.CC/N=C(\N)c1ccc(/C=C\c2ccc(/C(N)=N/CC)cc2)cc1 |
| InChI | InChI=1S/C20H24N4.2C3H6O3/c1-3-23-19(21)17-11-7-15(8-12-17)5-6-16-9-13-18(14-10-16)20(22)24-4-2;2*1-2(4)3(5)6/h5-14H,3-4H2,1-2H3,(H2,21,23)(H2,22,24);2*2,4H,1H3,(H,5,6)/b6-5-;; |
| InChIKey | DTHXLLUPABPCNJ-XNOMRPDFSA-N |
| XLogP | 2.21 |
| TPSA | 191.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|