C17H19N3 — CID 57029880
4-[2-[4-(aminomethyl)phenyl]ethenyl]-N'-methylbenzenecarboximidamide (PubChem CID 57029880) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)phenyl]ethenyl]-N'-methylbenzenecarboximidamide.
| Compound Name | 4-[2-[4-(aminomethyl)phenyl]ethenyl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 57029880 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-[2-[4-(aminomethyl)phenyl]ethenyl]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1ccc(C=Cc2ccc(CN)cc2)cc1 |
| InChI | InChI=1S/C17H19N3/c1-20-17(19)16-10-8-14(9-11-16)3-2-13-4-6-15(12-18)7-5-13/h2-11H,12,18H2,1H3,(H2,19,20) |
| InChIKey | BIFACJNBJQGMQF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|