C11H15N3O — CID 170487280
4-(4-aminobut-1-enyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 170487280) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-(4-aminobut-1-enyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(4-aminobut-1-enyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 170487280 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 4-(4-aminobut-1-enyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | NCCC=Cc1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C11H15N3O/c12-8-2-1-3-9-4-6-10(7-5-9)11(13)14-15/h1,3-7,15H,2,8,12H2,(H2,13,14) |
| InChIKey | KGXXISKNNOINLU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|