C20H22N4O3S — CID 50744365
4-(1-methylindol-5-yl)sulfonyl-N-phenylpiperazine-1-carboxamide (PubChem CID 50744365) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 4-(1-methylindol-5-yl)sulfonyl-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-(1-methylindol-5-yl)sulfonyl-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 50744365 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-(1-methylindol-5-yl)sulfonyl-N-phenylpiperazine-1-carboxamide |
| SMILES | Cn1ccc2cc(S(=O)(=O)N3CCN(C(=O)Nc4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C20H22N4O3S/c1-22-10-9-16-15-18(7-8-19(16)22)28(26,27)24-13-11-23(12-14-24)20(25)21-17-5-3-2-4-6-17/h2-10,15H,11-14H2,1H3,(H,21,25) |
| InChIKey | WJFKKTANKSQEML-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |