C24H28N4O5S — CID 50799015
methyl 2-[[4-(1-ethylindol-5-yl)sulfonyl-1,4-diazepane-1-carbonyl]amino]benzoate (PubChem CID 50799015) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is methyl 2-[[4-(1-ethylindol-5-yl)sulfonyl-1,4-diazepane-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(1-ethylindol-5-yl)sulfonyl-1,4-diazepane-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 50799015 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | methyl 2-[[4-(1-ethylindol-5-yl)sulfonyl-1,4-diazepane-1-carbonyl]amino]benzoate |
| SMILES | CCn1ccc2cc(S(=O)(=O)N3CCCN(C(=O)Nc4ccccc4C(=O)OC)CC3)ccc21 |
| InChI | InChI=1S/C24H28N4O5S/c1-3-26-14-11-18-17-19(9-10-22(18)26)34(31,32)28-13-6-12-27(15-16-28)24(30)25-21-8-5-4-7-20(21)23(29)33-2/h4-5,7-11,14,17H,3,6,12-13,15-16H2,1-2H3,(H,25,30) |
| InChIKey | GIJXZLSDFMDUDN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |