C15H18N2O4S — CID 20888287
2-(5-piperidin-1-ylsulfonylindol-1-yl)acetic acid (PubChem CID 20888287) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-(5-piperidin-1-ylsulfonylindol-1-yl)acetic acid.
| Compound Name | 2-(5-piperidin-1-ylsulfonylindol-1-yl)acetic acid |
|---|---|
| PubChem CID | 20888287 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-(5-piperidin-1-ylsulfonylindol-1-yl)acetic acid |
| SMILES | O=C(O)Cn1ccc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C15H18N2O4S/c18-15(19)11-16-9-6-12-10-13(4-5-14(12)16)22(20,21)17-7-2-1-3-8-17/h4-6,9-10H,1-3,7-8,11H2,(H,18,19) |
| InChIKey | WWECUJGACLOSMZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |