C22H32N4O3S — CID 20918879
2-(5-piperidin-1-ylsulfonylindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide (PubChem CID 20918879) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-(5-piperidin-1-ylsulfonylindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide.
| Compound Name | 2-(5-piperidin-1-ylsulfonylindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 20918879 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-(5-piperidin-1-ylsulfonylindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide |
| SMILES | O=C(Cn1ccc2cc(S(=O)(=O)N3CCCCC3)ccc21)NCCCN1CCCC1 |
| InChI | InChI=1S/C22H32N4O3S/c27-22(23-10-6-13-24-11-4-5-12-24)18-25-16-9-19-17-20(7-8-21(19)25)30(28,29)26-14-2-1-3-15-26/h7-9,16-17H,1-6,10-15,18H2,(H,23,27) |
| InChIKey | AINUJPPMVAQCPC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|