C21H29N3O3S — CID 46278693
N-cyclohexyl-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide (PubChem CID 46278693) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-cyclohexyl-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide.
| Compound Name | N-cyclohexyl-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide |
|---|---|
| PubChem CID | 46278693 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-cyclohexyl-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide |
| SMILES | O=C(CCn1ccc2cc(S(=O)(=O)N3CCCC3)ccc21)NC1CCCCC1 |
| InChI | InChI=1S/C21H29N3O3S/c25-21(22-18-6-2-1-3-7-18)11-15-23-14-10-17-16-19(8-9-20(17)23)28(26,27)24-12-4-5-13-24/h8-10,14,16,18H,1-7,11-13,15H2,(H,22,25) |
| InChIKey | QTLOVCKCWLRKJP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |