C22H31N3O3S — CID 92505046
N-[(1S,2R)-2-methylcyclohexyl]-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide (PubChem CID 92505046) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide |
|---|---|
| PubChem CID | 92505046 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-3-(5-pyrrolidin-1-ylsulfonylindol-1-yl)propanamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)CCn1ccc2cc(S(=O)(=O)N3CCCC3)ccc21 |
| InChI | InChI=1S/C22H31N3O3S/c1-17-6-2-3-7-20(17)23-22(26)11-15-24-14-10-18-16-19(8-9-21(18)24)29(27,28)25-12-4-5-13-25/h8-10,14,16-17,20H,2-7,11-13,15H2,1H3,(H,23,26)/t17-,20+/m1/s1 |
| InChIKey | CZPSTNVWNRKCJZ-XLIONFOSSA-N |
| XLogP | 3.51 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |