C22H31N3O3S — CID 92712238
(3S)-N-cycloheptyl-1-(1-methylindol-5-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 92712238) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is (3S)-N-cycloheptyl-1-(1-methylindol-5-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-cycloheptyl-1-(1-methylindol-5-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92712238 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (3S)-N-cycloheptyl-1-(1-methylindol-5-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cn1ccc2cc(S(=O)(=O)N3CCC[C@H](C(=O)NC4CCCCCC4)C3)ccc21 |
| InChI | InChI=1S/C22H31N3O3S/c1-24-14-12-17-15-20(10-11-21(17)24)29(27,28)25-13-6-7-18(16-25)22(26)23-19-8-4-2-3-5-9-19/h10-12,14-15,18-19H,2-9,13,16H2,1H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | MLGOLNUDQXXABT-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |