C31H35F3N4O7S — CID 143561743
methyl 2-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbonyl]amino]benzoate;N-[(4-propylphenyl)methyl]formamide (PubChem CID 143561743) has the molecular formula C31H35F3N4O7S and a molecular weight of 664.70 g/mol. Its IUPAC name is methyl 2-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbonyl]amino]benzoate;N-[(4-propylphenyl)methyl]formamide.
| Compound Name | methyl 2-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbonyl]amino]benzoate;N-[(4-propylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 143561743 |
| Molecular Formula | C31H35F3N4O7S |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | methyl 2-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbonyl]amino]benzoate;N-[(4-propylphenyl)methyl]formamide |
| SMILES | CCCc1ccc(CNC=O)cc1.COC(=O)c1ccccc1NC(=O)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H20F3N3O6S.C11H15NO/c1-31-18(27)16-4-2-3-5-17(16)24-19(28)25-10-12-26(13-11-25)33(29,30)15-8-6-14(7-9-15)32-20(21,22)23;1-2-3-10-4-6-11(7-5-10)8-12-9-13/h2-9H,10-13H2,1H3,(H,24,28);4-7,9H,2-3,8H2,1H3,(H,12,13) |
| InChIKey | JDIQMZLIFSCMTO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|