C18H19F3N4O6S — CID 46583825
N'-(2-methylfuran-3-carbonyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbohydrazide (PubChem CID 46583825) has the molecular formula C18H19F3N4O6S and a molecular weight of 476.43 g/mol. Its IUPAC name is N'-(2-methylfuran-3-carbonyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbohydrazide.
| Compound Name | N'-(2-methylfuran-3-carbonyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbohydrazide |
|---|---|
| PubChem CID | 46583825 |
| Molecular Formula | C18H19F3N4O6S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N'-(2-methylfuran-3-carbonyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H19F3N4O6S/c1-12-15(6-11-30-12)16(26)22-23-17(27)24-7-9-25(10-8-24)32(28,29)14-4-2-13(3-5-14)31-18(19,20)21/h2-6,11H,7-10H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | RPTGRDXNMORLGA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|