C16H15F3N2O5S — CID 24531914
furan-3-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 24531914) has the molecular formula C16H15F3N2O5S and a molecular weight of 404.37 g/mol. Its IUPAC name is furan-3-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | furan-3-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24531914 |
| Molecular Formula | C16H15F3N2O5S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | furan-3-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H15F3N2O5S/c17-16(18,19)26-13-1-3-14(4-2-13)27(23,24)21-8-6-20(7-9-21)15(22)12-5-10-25-11-12/h1-5,10-11H,6-9H2 |
| InChIKey | BUZOBSJUOFPOTE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |