C17H16F3N3O4S — CID 4875578
pyridin-4-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 4875578) has the molecular formula C17H16F3N3O4S and a molecular weight of 415.39 g/mol. Its IUPAC name is pyridin-4-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | pyridin-4-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4875578 |
| Molecular Formula | C17H16F3N3O4S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | pyridin-4-yl-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccncc1)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H16F3N3O4S/c18-17(19,20)27-14-1-3-15(4-2-14)28(25,26)23-11-9-22(10-12-23)16(24)13-5-7-21-8-6-13/h1-8H,9-12H2 |
| InChIKey | PWAKGVGKAHXHDH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |