C15H10ClF3N2O — CID 59811399
N-(2-chloro-4-pyridinyl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide (PubChem CID 59811399) has the molecular formula C15H10ClF3N2O and a molecular weight of 326.71 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 59811399 |
| Molecular Formula | C15H10ClF3N2O |
| Molecular Weight | 326.71 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide |
| SMILES | O=C(Nc1ccnc(Cl)c1)c1ccc(/C=C/C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10ClF3N2O/c16-13-9-12(6-8-20-13)21-14(22)11-3-1-10(2-4-11)5-7-15(17,18)19/h1-9H,(H,20,21,22)/b7-5+ |
| InChIKey | FKCRMZBAVLWOIJ-FNORWQNLSA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|