C13H10Cl2N4O2 — CID 86045636
N,N'-bis(2-chloro-4-pyridinyl)propanediamide (PubChem CID 86045636) has the molecular formula C13H10Cl2N4O2 and a molecular weight of 325.16 g/mol. Its IUPAC name is N,N'-bis(2-chloro-4-pyridinyl)propanediamide.
| Compound Name | N,N'-bis(2-chloro-4-pyridinyl)propanediamide |
|---|---|
| PubChem CID | 86045636 |
| Molecular Formula | C13H10Cl2N4O2 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N,N'-bis(2-chloro-4-pyridinyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1ccnc(Cl)c1)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N4O2/c14-10-5-8(1-3-16-10)18-12(20)7-13(21)19-9-2-4-17-11(15)6-9/h1-6H,7H2,(H,16,18,20)(H,17,19,21) |
| InChIKey | HPOFYJMDQHFMSW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|