C12H7ClF3N3O — CID 150183067
1-(2-chloro-4-pyridinyl)-3-(3,4,5-trifluorophenyl)urea (PubChem CID 150183067) has the molecular formula C12H7ClF3N3O and a molecular weight of 301.66 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-(2-chloro-4-pyridinyl)-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 150183067 |
| Molecular Formula | C12H7ClF3N3O |
| Molecular Weight | 301.66 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-3-(3,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccnc(Cl)c1)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H7ClF3N3O/c13-10-5-6(1-2-17-10)18-12(20)19-7-3-8(14)11(16)9(15)4-7/h1-5H,(H2,17,18,19,20) |
| InChIKey | FLVKALKKBPZTFV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|