C15H10ClFN4OS — CID 152663942
1-(2-chloro-4-pyridinyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]urea (PubChem CID 152663942) has the molecular formula C15H10ClFN4OS and a molecular weight of 348.79 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(2-chloro-4-pyridinyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 152663942 |
| Molecular Formula | C15H10ClFN4OS |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1ccnc(Cl)c1)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C15H10ClFN4OS/c16-13-7-11(5-6-18-13)19-14(22)21-15-20-12(8-23-15)9-1-3-10(17)4-2-9/h1-8H,(H2,18,19,20,21,22) |
| InChIKey | ZKCWMLPIIVGTES-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|