C14H14ClFN2OS — CID 63679014
3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 63679014) has the molecular formula C14H14ClFN2OS and a molecular weight of 312.80 g/mol. Its IUPAC name is 3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63679014 |
| Molecular Formula | C14H14ClFN2OS |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C14H14ClFN2OS/c1-14(2,8-15)12(19)18-13-17-11(7-20-13)9-3-5-10(16)6-4-9/h3-7H,8H2,1-2H3,(H,17,18,19) |
| InChIKey | BMXLRCWPUFMNII-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|