C16H7F13N2OS — CID 4196747
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]heptanamide (PubChem CID 4196747) has the molecular formula C16H7F13N2OS and a molecular weight of 522.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]heptanamide |
|---|---|
| PubChem CID | 4196747 |
| Molecular Formula | C16H7F13N2OS |
| Molecular Weight | 522.29 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]heptanamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)cs1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H7F13N2OS/c17-7-3-1-6(2-4-7)8-5-33-11(30-8)31-10(32)13(22,23)15(26,27)16(28,29)14(24,25)12(20,21)9(18)19/h1-5,9H,(H,30,31,32) |
| InChIKey | GUJSEJJAUDRGOY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.29 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|