C14H8F8N2OS — CID 5087587
2,2,3,3,4,4,5,5-octafluoro-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide (PubChem CID 5087587) has the molecular formula C14H8F8N2OS and a molecular weight of 404.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 5087587 |
| Molecular Formula | C14H8F8N2OS |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H8F8N2OS/c15-9(16)12(17,18)14(21,22)13(19,20)10(25)24-11-23-8(6-26-11)7-4-2-1-3-5-7/h1-6,9H,(H,23,24,25) |
| InChIKey | DUIQKRCRCIBPSP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|