C15H11N3O2S — CID 87406304
phenyl N-(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamate (PubChem CID 87406304) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is phenyl N-(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamate.
| Compound Name | phenyl N-(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 87406304 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | phenyl N-(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamate |
| SMILES | O=C(Nc1nc(-c2ccncc2)cs1)Oc1ccccc1 |
| InChI | InChI=1S/C15H11N3O2S/c19-15(20-12-4-2-1-3-5-12)18-14-17-13(10-21-14)11-6-8-16-9-7-11/h1-10H,(H,17,18,19) |
| InChIKey | JEKAYFHYHBTNIB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |