C13H14FN3O4S — CID 13177617
2-aminoethanol;2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid (PubChem CID 13177617) has the molecular formula C13H14FN3O4S and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-aminoethanol;2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-aminoethanol;2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 13177617 |
| Molecular Formula | C13H14FN3O4S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-aminoethanol;2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
| SMILES | NCCO.O=C(O)C(=O)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C11H7FN2O3S.C2H7NO/c12-7-3-1-6(2-4-7)8-5-18-11(13-8)14-9(15)10(16)17;3-1-2-4/h1-5H,(H,16,17)(H,13,14,15);4H,1-3H2 |
| InChIKey | TVWPMGNPJCFJNR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|