C19H19N3O4S2 — CID 13177627
2-aminoethanol;2-oxo-2-[[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]amino]acetic acid (PubChem CID 13177627) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-aminoethanol;2-oxo-2-[[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]amino]acetic acid.
| Compound Name | 2-aminoethanol;2-oxo-2-[[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 13177627 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 2-aminoethanol;2-oxo-2-[[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]amino]acetic acid |
| SMILES | NCCO.O=C(O)C(=O)Nc1nc(-c2ccc(Sc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C17H12N2O3S2.C2H7NO/c20-15(16(21)22)19-17-18-14(10-23-17)11-6-8-13(9-7-11)24-12-4-2-1-3-5-12;3-1-2-4/h1-10H,(H,21,22)(H,18,19,20);4H,1-3H2 |
| InChIKey | CANGFTIWIMPAIA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|