C20H23N5O6S — CID 14814748
(2S)-2,6-diaminohexanoic acid;2-oxo-2-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]acetic acid (PubChem CID 14814748) has the molecular formula C20H23N5O6S and a molecular weight of 461.50 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;2-oxo-2-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]acetic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;2-oxo-2-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 14814748 |
| Molecular Formula | C20H23N5O6S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;2-oxo-2-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]amino]acetic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C(O)C(=O)Nc1nc(-c2cc(-c3ccccc3)no2)cs1 |
| InChI | InChI=1S/C14H9N3O4S.C6H14N2O2/c18-12(13(19)20)16-14-15-10(7-22-14)11-6-9(17-21-11)8-4-2-1-3-5-8;7-4-2-1-3-5(8)6(9)10/h1-7H,(H,19,20)(H,15,16,18);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | JEBNXWXGLDKVPK-ZSCHJXSPSA-N |
| XLogP | 2.02 |
| TPSA | 194.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|