C16H20N4O3S — CID 175099310
[5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamic acid (PubChem CID 175099310) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is [5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamic acid.
| Compound Name | [5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamic acid |
|---|---|
| PubChem CID | 175099310 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [5-amino-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]carbamic acid |
| SMILES | NC(CCCCNC(=O)O)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H20N4O3S/c17-12(8-4-5-9-18-16(22)23)14(21)20-15-19-13(10-24-15)11-6-2-1-3-7-11/h1-3,6-7,10,12,18H,4-5,8-9,17H2,(H,22,23)(H,19,20,21) |
| InChIKey | BSNUDLLNRDTNDC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|