C25H28N4O5S — CID 73046360
benzyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate (PubChem CID 73046360) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is benzyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate.
| Compound Name | benzyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate |
|---|---|
| PubChem CID | 73046360 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | benzyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate |
| SMILES | O=C(CCCCCC(NC(=O)OCc1ccccc1)C(=O)Nc1nc(-c2ccccc2)cs1)NO |
| InChI | InChI=1S/C25H28N4O5S/c30-22(29-33)15-9-3-8-14-20(27-25(32)34-16-18-10-4-1-5-11-18)23(31)28-24-26-21(17-35-24)19-12-6-2-7-13-19/h1-2,4-7,10-13,17,20,33H,3,8-9,14-16H2,(H,27,32)(H,29,30)(H,26,28,31) |
| InChIKey | UMJKIKOLOWWTNX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|