C20H27N5O7S2 — CID 44572405
ethyl 2-[[(2S)-2-(phenylmethoxycarbonylamino)-6-(sulfamoylamino)hexanoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 44572405) has the molecular formula C20H27N5O7S2 and a molecular weight of 513.60 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-(phenylmethoxycarbonylamino)-6-(sulfamoylamino)hexanoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(2S)-2-(phenylmethoxycarbonylamino)-6-(sulfamoylamino)hexanoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 44572405 |
| Molecular Formula | C20H27N5O7S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | ethyl 2-[[(2S)-2-(phenylmethoxycarbonylamino)-6-(sulfamoylamino)hexanoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)[C@H](CCCCNS(N)(=O)=O)NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C20H27N5O7S2/c1-2-31-18(27)16-13-33-19(23-16)25-17(26)15(10-6-7-11-22-34(21,29)30)24-20(28)32-12-14-8-4-3-5-9-14/h3-5,8-9,13,15,22H,2,6-7,10-12H2,1H3,(H,24,28)(H2,21,29,30)(H,23,25,26)/t15-/m0/s1 |
| InChIKey | SYAMEMREWUISRT-HNNXBMFYSA-N |
| XLogP | 1.52 |
| TPSA | 178.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|