C24H29N5O6S — CID 74430725
benzyl N-[1-[(6-methoxyquinolin-8-yl)amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate (PubChem CID 74430725) has the molecular formula C24H29N5O6S and a molecular weight of 515.59 g/mol. Its IUPAC name is benzyl N-[1-[(6-methoxyquinolin-8-yl)amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(6-methoxyquinolin-8-yl)amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 74430725 |
| Molecular Formula | C24H29N5O6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | benzyl N-[1-[(6-methoxyquinolin-8-yl)amino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]carbamate |
| SMILES | COc1cc(NC(=O)C(CCCCNS(N)(=O)=O)NC(=O)OCc2ccccc2)c2ncccc2c1 |
| InChI | InChI=1S/C24H29N5O6S/c1-34-19-14-18-10-7-12-26-22(18)21(15-19)28-23(30)20(11-5-6-13-27-36(25,32)33)29-24(31)35-16-17-8-3-2-4-9-17/h2-4,7-10,12,14-15,20,27H,5-6,11,13,16H2,1H3,(H,28,30)(H,29,31)(H2,25,32,33) |
| InChIKey | VBRYMHVURZBROJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 161.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|