C28H36N6O6S — CID 69407277
tert-butyl N-[[(5S)-5-(benzylcarbamoylamino)-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate (PubChem CID 69407277) has the molecular formula C28H36N6O6S and a molecular weight of 584.70 g/mol. Its IUPAC name is tert-butyl N-[[(5S)-5-(benzylcarbamoylamino)-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[[(5S)-5-(benzylcarbamoylamino)-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 69407277 |
| Molecular Formula | C28H36N6O6S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | tert-butyl N-[[(5S)-5-(benzylcarbamoylamino)-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCCCC[C@H](NC(=O)NCc1ccccc1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C28H36N6O6S/c1-28(2,3)40-27(37)34-41(38,39)31-18-8-7-15-23(33-26(36)30-19-20-11-5-4-6-12-20)25(35)32-22-16-9-13-21-14-10-17-29-24(21)22/h4-6,9-14,16-17,23,31H,7-8,15,18-19H2,1-3H3,(H,32,35)(H,34,37)(H2,30,33,36)/t23-/m0/s1 |
| InChIKey | KFDSARDIHOMOSG-QHCPKHFHSA-N |
| XLogP | 3.57 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|