C18H23N3O3 — CID 51217671
tert-butyl N-[4-oxo-4-(quinolin-8-ylamino)butyl]carbamate (PubChem CID 51217671) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-(quinolin-8-ylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-(quinolin-8-ylamino)butyl]carbamate |
|---|---|
| PubChem CID | 51217671 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | tert-butyl N-[4-oxo-4-(quinolin-8-ylamino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2,3)24-17(23)20-12-6-10-15(22)21-14-9-4-7-13-8-5-11-19-16(13)14/h4-5,7-9,11H,6,10,12H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | VDYLWTROJPFNOG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|