C15H20N4O3S — CID 25216936
N-quinolin-8-yl-6-(sulfamoylamino)hexanamide (PubChem CID 25216936) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is N-quinolin-8-yl-6-(sulfamoylamino)hexanamide.
| Compound Name | N-quinolin-8-yl-6-(sulfamoylamino)hexanamide |
|---|---|
| PubChem CID | 25216936 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-quinolin-8-yl-6-(sulfamoylamino)hexanamide |
| SMILES | NS(=O)(=O)NCCCCCC(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C15H20N4O3S/c16-23(21,22)18-11-3-1-2-9-14(20)19-13-8-4-6-12-7-5-10-17-15(12)13/h4-8,10,18H,1-3,9,11H2,(H,19,20)(H2,16,21,22) |
| InChIKey | IQEBALPYRTUOEG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|