C27H38N2O — CID 162681597
(9E,12E)-N-quinolin-8-yloctadeca-9,12-dienamide (PubChem CID 162681597) has the molecular formula C27H38N2O and a molecular weight of 406.61 g/mol. Its IUPAC name is (9E,12E)-N-quinolin-8-yloctadeca-9,12-dienamide.
| Compound Name | (9E,12E)-N-quinolin-8-yloctadeca-9,12-dienamide |
|---|---|
| PubChem CID | 162681597 |
| Molecular Formula | C27H38N2O |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | (9E,12E)-N-quinolin-8-yloctadeca-9,12-dienamide |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C27H38N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-26(30)29-25-21-17-19-24-20-18-23-28-27(24)25/h6-7,9-10,17-21,23H,2-5,8,11-16,22H2,1H3,(H,29,30)/b7-6+,10-9+ |
| InChIKey | KGXOHVCXOFCZKU-AVQMFFATSA-N |
| XLogP | 7.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|