C25H34N2O — CID 174987789
(E)-4-propylidene-N-quinolin-8-yltridec-6-enamide (PubChem CID 174987789) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is (E)-4-propylidene-N-quinolin-8-yltridec-6-enamide.
| Compound Name | (E)-4-propylidene-N-quinolin-8-yltridec-6-enamide |
|---|---|
| PubChem CID | 174987789 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (E)-4-propylidene-N-quinolin-8-yltridec-6-enamide |
| SMILES | CCC=C(C/C=C/CCCCCC)CCC(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C25H34N2O/c1-3-5-6-7-8-9-10-14-21(13-4-2)18-19-24(28)27-23-17-11-15-22-16-12-20-26-25(22)23/h9-13,15-17,20H,3-8,14,18-19H2,1-2H3,(H,27,28)/b10-9+,21-13? |
| InChIKey | RNCKTNQMXHQZNM-PXXYWNIOSA-N |
| XLogP | 7.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|