C26H37NO2 — CID 54249873
N-(2-hydroxyphenyl)icosa-5,8,11,14-tetraenamide (PubChem CID 54249873) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)icosa-5,8,11,14-tetraenamide.
| Compound Name | N-(2-hydroxyphenyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 54249873 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N-(2-hydroxyphenyl)icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)Nc1ccccc1O |
| InChI | InChI=1S/C26H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-26(29)27-24-21-19-20-22-25(24)28/h6-7,9-10,12-13,15-16,19-22,28H,2-5,8,11,14,17-18,23H2,1H3,(H,27,29) |
| InChIKey | QVZOWUCARQBOOX-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|