C27H41NO2 — CID 57260775
N-(4-hydroxy-2,3,5-trimethylphenyl)octadeca-6,9,12-trienamide (PubChem CID 57260775) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is N-(4-hydroxy-2,3,5-trimethylphenyl)octadeca-6,9,12-trienamide.
| Compound Name | N-(4-hydroxy-2,3,5-trimethylphenyl)octadeca-6,9,12-trienamide |
|---|---|
| PubChem CID | 57260775 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | N-(4-hydroxy-2,3,5-trimethylphenyl)octadeca-6,9,12-trienamide |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)Nc1cc(C)c(O)c(C)c1C |
| InChI | InChI=1S/C27H41NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(29)28-25-21-22(2)27(30)24(4)23(25)3/h9-10,12-13,15-16,21,30H,5-8,11,14,17-20H2,1-4H3,(H,28,29) |
| InChIKey | HULBDFVCYAOCMW-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|