C20H29N5O5S — CID 69446621
butyl N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate (PubChem CID 69446621) has the molecular formula C20H29N5O5S and a molecular weight of 451.55 g/mol. Its IUPAC name is butyl N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate.
| Compound Name | butyl N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 69446621 |
| Molecular Formula | C20H29N5O5S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | butyl N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]carbamate |
| SMILES | CCCCOC(=O)NC(CCCCNS(N)(=O)=O)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H29N5O5S/c1-2-3-14-30-20(27)25-17(10-4-5-13-23-31(21,28)29)19(26)24-16-11-6-8-15-9-7-12-22-18(15)16/h6-9,11-12,17,23H,2-5,10,13-14H2,1H3,(H,24,26)(H,25,27)(H2,21,28,29) |
| InChIKey | YWEVFQXTRLPPHW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|